C26H36FN3O4S — CID 133149701
2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-pentylpropanamide (PubChem CID 133149701) has the molecular formula C26H36FN3O4S and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-pentylpropanamide.
| Compound Name | 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-pentylpropanamide |
|---|---|
| PubChem CID | 133149701 |
| Molecular Formula | C26H36FN3O4S |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)C(C)N(Cc1ccc(F)cc1)C(=O)CCc1ccc(S(=O)(=O)NCC)cc1 |
| InChI | InChI=1S/C26H36FN3O4S/c1-4-6-7-18-28-26(32)20(3)30(19-22-8-13-23(27)14-9-22)25(31)17-12-21-10-15-24(16-11-21)35(33,34)29-5-2/h8-11,13-16,20,29H,4-7,12,17-19H2,1-3H3,(H,28,32) |
| InChIKey | VLBFSTAMSLRSAX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|