C25H34FN3O5S — CID 133149680
2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)propanamide (PubChem CID 133149680) has the molecular formula C25H34FN3O5S and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 133149680 |
| Molecular Formula | C25H34FN3O5S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)propanamide |
| SMILES | CCNS(=O)(=O)c1ccc(CCC(=O)N(Cc2ccc(F)cc2)C(C)C(=O)NCCCOC)cc1 |
| InChI | InChI=1S/C25H34FN3O5S/c1-4-28-35(32,33)23-13-8-20(9-14-23)10-15-24(30)29(18-21-6-11-22(26)12-7-21)19(2)25(31)27-16-5-17-34-3/h6-9,11-14,19,28H,4-5,10,15-18H2,1-3H3,(H,27,31) |
| InChIKey | CGYOWUVTNAQPAC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|