C27H39N3O6S — CID 133213319
N-(3-ethoxypropyl)-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 133213319) has the molecular formula C27H39N3O6S and a molecular weight of 533.69 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-(3-ethoxypropyl)-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 133213319 |
| Molecular Formula | C27H39N3O6S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCNS(=O)(=O)c1ccc(CCC(=O)N(Cc2ccc(OC)cc2)C(C)C(=O)NCCCOCC)cc1 |
| InChI | InChI=1S/C27H39N3O6S/c1-5-29-37(33,34)25-15-10-22(11-16-25)12-17-26(31)30(20-23-8-13-24(35-4)14-9-23)21(3)27(32)28-18-7-19-36-6-2/h8-11,13-16,21,29H,5-7,12,17-20H2,1-4H3,(H,28,32) |
| InChIKey | RCUACPCYLJBBSY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|