C25H34FN3O4S — CID 133149662
N-butyl-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]propanamide (PubChem CID 133149662) has the molecular formula C25H34FN3O4S and a molecular weight of 491.63 g/mol. Its IUPAC name is N-butyl-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 133149662 |
| Molecular Formula | C25H34FN3O4S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-butyl-2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(F)cc1)C(=O)CCc1ccc(S(=O)(=O)NCC)cc1 |
| InChI | InChI=1S/C25H34FN3O4S/c1-4-6-17-27-25(31)19(3)29(18-21-7-12-22(26)13-8-21)24(30)16-11-20-9-14-23(15-10-20)34(32,33)28-5-2/h7-10,12-15,19,28H,4-6,11,16-18H2,1-3H3,(H,27,31) |
| InChIKey | MRZKLYUJPKBLGY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|