C24H32FN3O5S — CID 133149679
2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-hydroxypropyl)propanamide (PubChem CID 133149679) has the molecular formula C24H32FN3O5S and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-hydroxypropyl)propanamide.
| Compound Name | 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 133149679 |
| Molecular Formula | C24H32FN3O5S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[3-[4-(ethylsulfamoyl)phenyl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-(3-hydroxypropyl)propanamide |
| SMILES | CCNS(=O)(=O)c1ccc(CCC(=O)N(Cc2ccc(F)cc2)C(C)C(=O)NCCCO)cc1 |
| InChI | InChI=1S/C24H32FN3O5S/c1-3-27-34(32,33)22-12-7-19(8-13-22)9-14-23(30)28(17-20-5-10-21(25)11-6-20)18(2)24(31)26-15-4-16-29/h5-8,10-13,18,27,29H,3-4,9,14-17H2,1-2H3,(H,26,31) |
| InChIKey | MSFQPOVIBBFERO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|