C30H46BN5O3 — CID 58361543
N-[(2S,5R)-5-[5-(6-aminohexyl)-3,5-dimethyl-1,3,2-oxazaborolidin-2-yl]-7-methyl-3-oxo-1-phenyloctan-2-yl]pyrazine-2-carboxamide (PubChem CID 58361543) has the molecular formula C30H46BN5O3 and a molecular weight of 535.54 g/mol. Its IUPAC name is N-[(2S,5R)-5-[5-(6-aminohexyl)-3,5-dimethyl-1,3,2-oxazaborolidin-2-yl]-7-methyl-3-oxo-1-phenyloctan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S,5R)-5-[5-(6-aminohexyl)-3,5-dimethyl-1,3,2-oxazaborolidin-2-yl]-7-methyl-3-oxo-1-phenyloctan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58361543 |
| Molecular Formula | C30H46BN5O3 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.37 |
| IUPAC Name | N-[(2S,5R)-5-[5-(6-aminohexyl)-3,5-dimethyl-1,3,2-oxazaborolidin-2-yl]-7-methyl-3-oxo-1-phenyloctan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1OC(C)(CCCCCCN)CN1C |
| InChI | InChI=1S/C30H46BN5O3/c1-23(2)18-25(31-36(4)22-30(3,39-31)14-10-5-6-11-15-32)20-28(37)26(19-24-12-8-7-9-13-24)35-29(38)27-21-33-16-17-34-27/h7-9,12-13,16-17,21,23,25-26H,5-6,10-11,14-15,18-20,22,32H2,1-4H3,(H,35,38)/t25-,26+,30?/m1/s1 |
| InChIKey | IVQRVBNOVIWDQG-UFZRHRTKSA-N |
| XLogP | 4.31 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|