C19H24BClN4O6 — CID 174051411
[3-(4-chloro-2-methylphenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid (PubChem CID 174051411) has the molecular formula C19H24BClN4O6 and a molecular weight of 450.69 g/mol. Its IUPAC name is [3-(4-chloro-2-methylphenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid.
| Compound Name | [3-(4-chloro-2-methylphenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid |
|---|---|
| PubChem CID | 174051411 |
| Molecular Formula | C19H24BClN4O6 |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [3-(4-chloro-2-methylphenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(CCOc1ccc(Cl)cc1C)B(O)O |
| InChI | InChI=1S/C19H24BClN4O6/c1-12-9-13(21)3-4-16(12)31-8-5-17(20(28)29)25-19(27)15(11-30-2)24-18(26)14-10-22-6-7-23-14/h3-4,6-7,9-10,15,17,28-29H,5,8,11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | BYPNIQSNIASWEX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|