C14H12Cl2N4O3 — CID 1108004
N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]pyrazine-2-carbohydrazide (PubChem CID 1108004) has the molecular formula C14H12Cl2N4O3 and a molecular weight of 355.18 g/mol. Its IUPAC name is N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 1108004 |
| Molecular Formula | C14H12Cl2N4O3 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N'-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]pyrazine-2-carbohydrazide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C14H12Cl2N4O3/c1-8(23-12-3-2-9(15)6-10(12)16)13(21)19-20-14(22)11-7-17-4-5-18-11/h2-8H,1H3,(H,19,21)(H,20,22)/t8-/m1/s1 |
| InChIKey | QFGVYPROYFCQJG-MRVPVSSYSA-N |
| XLogP | 2.01 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|