C20H27BN4O5 — CID 174051925
5-[2-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]phenyl]pentan-2-ylboronic acid (PubChem CID 174051925) has the molecular formula C20H27BN4O5 and a molecular weight of 414.27 g/mol. Its IUPAC name is 5-[2-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]phenyl]pentan-2-ylboronic acid.
| Compound Name | 5-[2-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]phenyl]pentan-2-ylboronic acid |
|---|---|
| PubChem CID | 174051925 |
| Molecular Formula | C20H27BN4O5 |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 5-[2-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]phenyl]pentan-2-ylboronic acid |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)Nc1ccccc1CCCC(C)B(O)O |
| InChI | InChI=1S/C20H27BN4O5/c1-14(21(28)29)6-5-8-15-7-3-4-9-16(15)24-20(27)18(13-30-2)25-19(26)17-12-22-10-11-23-17/h3-4,7,9-12,14,18,28-29H,5-6,8,13H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | CUEALEJWQFNXAN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|