C14H20BN5O6 — CID 168919748
[[(2R)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]methylboronic acid (PubChem CID 168919748) has the molecular formula C14H20BN5O6 and a molecular weight of 365.16 g/mol. Its IUPAC name is [[(2R)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]methylboronic acid.
| Compound Name | [[(2R)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 168919748 |
| Molecular Formula | C14H20BN5O6 |
| Molecular Weight | 365.16 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | [[(2R)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]methylboronic acid |
| SMILES | O=C(N[C@H](CC(=O)N1CCOCC1)C(=O)NCB(O)O)c1cnccn1 |
| InChI | InChI=1S/C14H20BN5O6/c21-12(20-3-5-26-6-4-20)7-10(13(22)18-9-15(24)25)19-14(23)11-8-16-1-2-17-11/h1-2,8,10,24-25H,3-7,9H2,(H,18,22)(H,19,23)/t10-/m1/s1 |
| InChIKey | ALEGEGKIXVJFLH-SNVBAGLBSA-N |
| XLogP | -3.05 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.16 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|