C17H24BN5O6 — CID 168919865
[(1R)-1-[[(E)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)but-2-enoyl]amino]butyl]boronic acid (PubChem CID 168919865) has the molecular formula C17H24BN5O6 and a molecular weight of 405.22 g/mol. Its IUPAC name is [(1R)-1-[[(E)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)but-2-enoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-1-[[(E)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)but-2-enoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 168919865 |
| Molecular Formula | C17H24BN5O6 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [(1R)-1-[[(E)-4-morpholin-4-yl-4-oxo-2-(pyrazine-2-carbonylamino)but-2-enoyl]amino]butyl]boronic acid |
| SMILES | CCC[C@H](NC(=O)/C(=C\C(=O)N1CCOCC1)NC(=O)c1cnccn1)B(O)O |
| InChI | InChI=1S/C17H24BN5O6/c1-2-3-14(18(27)28)22-16(25)12(10-15(24)23-6-8-29-9-7-23)21-17(26)13-11-19-4-5-20-13/h4-5,10-11,14,27-28H,2-3,6-9H2,1H3,(H,21,26)(H,22,25)/b12-10+/t14-/m0/s1 |
| InChIKey | TWKSOAGXSRITOQ-WONIAPNHSA-N |
| XLogP | -1.75 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|