C20H30N4O2S — CID 147425588
N-[(Z)-1-cyclohexyl-3-[[(1R)-2,2-dimethyl-1-methylsulfanylpropyl]amino]-3-oxoprop-1-en-2-yl]pyrazine-2-carboxamide (PubChem CID 147425588) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-[(Z)-1-cyclohexyl-3-[[(1R)-2,2-dimethyl-1-methylsulfanylpropyl]amino]-3-oxoprop-1-en-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(Z)-1-cyclohexyl-3-[[(1R)-2,2-dimethyl-1-methylsulfanylpropyl]amino]-3-oxoprop-1-en-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 147425588 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[(Z)-1-cyclohexyl-3-[[(1R)-2,2-dimethyl-1-methylsulfanylpropyl]amino]-3-oxoprop-1-en-2-yl]pyrazine-2-carboxamide |
| SMILES | CS[C@@H](NC(=O)/C(=C/C1CCCCC1)NC(=O)c1cnccn1)C(C)(C)C |
| InChI | InChI=1S/C20H30N4O2S/c1-20(2,3)19(27-4)24-17(25)15(12-14-8-6-5-7-9-14)23-18(26)16-13-21-10-11-22-16/h10-14,19H,5-9H2,1-4H3,(H,23,26)(H,24,25)/b15-12-/t19-/m1/s1 |
| InChIKey | DTIGXPQJVAVASY-LJQBUTKESA-N |
| XLogP | 3.52 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|