C16H22BN5O6 — CID 174051837
N-[1-[[(3R)-2-hydroxyoxaborolan-3-yl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]pyrazine-2-carboxamide (PubChem CID 174051837) has the molecular formula C16H22BN5O6 and a molecular weight of 391.19 g/mol. Its IUPAC name is N-[1-[[(3R)-2-hydroxyoxaborolan-3-yl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-[[(3R)-2-hydroxyoxaborolan-3-yl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174051837 |
| Molecular Formula | C16H22BN5O6 |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[1-[[(3R)-2-hydroxyoxaborolan-3-yl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC(CC(=O)N1CCOCC1)C(=O)N[C@H]1CCOB1O)c1cnccn1 |
| InChI | InChI=1S/C16H22BN5O6/c23-14(22-4-7-27-8-5-22)9-11(15(24)21-13-1-6-28-17(13)26)20-16(25)12-10-18-2-3-19-12/h2-3,10-11,13,26H,1,4-9H2,(H,20,25)(H,21,24)/t11?,13-/m0/s1 |
| InChIKey | ZQJPJWSLWLLKTQ-YUZLPWPTSA-N |
| XLogP | -2.25 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|