C24H38BN5O4S2 — CID 168919881
[(Z,5Z)-5-ethylidene-1-[[4-morpholin-4-yl-2-[(pyrazin-2-ylsulfanylamino)methyl]-4-sulfanylidenebutanoyl]amino]non-6-enyl]boronic acid (PubChem CID 168919881) has the molecular formula C24H38BN5O4S2 and a molecular weight of 535.55 g/mol. Its IUPAC name is [(Z,5Z)-5-ethylidene-1-[[4-morpholin-4-yl-2-[(pyrazin-2-ylsulfanylamino)methyl]-4-sulfanylidenebutanoyl]amino]non-6-enyl]boronic acid.
| Compound Name | [(Z,5Z)-5-ethylidene-1-[[4-morpholin-4-yl-2-[(pyrazin-2-ylsulfanylamino)methyl]-4-sulfanylidenebutanoyl]amino]non-6-enyl]boronic acid |
|---|---|
| PubChem CID | 168919881 |
| Molecular Formula | C24H38BN5O4S2 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | [(Z,5Z)-5-ethylidene-1-[[4-morpholin-4-yl-2-[(pyrazin-2-ylsulfanylamino)methyl]-4-sulfanylidenebutanoyl]amino]non-6-enyl]boronic acid |
| SMILES | C/C=C(\C=C/CC)CCCC(NC(=O)C(CNSc1cnccn1)CC(=S)N1CCOCC1)B(O)O |
| InChI | InChI=1S/C24H38BN5O4S2/c1-3-5-7-19(4-2)8-6-9-21(25(32)33)29-24(31)20(16-23(35)30-12-14-34-15-13-30)17-28-36-22-18-26-10-11-27-22/h4-5,7,10-11,18,20-21,28,32-33H,3,6,8-9,12-17H2,1-2H3,(H,29,31)/b7-5-,19-4+ |
| InChIKey | CIBNQFCZYOTMLG-DILMWHCASA-N |
| XLogP | 2.32 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|