C30H40BN5O6 — CID 168919640
N-[2-(morpholine-4-carbonyl)-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide (PubChem CID 168919640) has the molecular formula C30H40BN5O6 and a molecular weight of 577.49 g/mol. Its IUPAC name is N-[2-(morpholine-4-carbonyl)-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(morpholine-4-carbonyl)-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168919640 |
| Molecular Formula | C30H40BN5O6 |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | N-[2-(morpholine-4-carbonyl)-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)C2(NC(=O)c3cnccn3)CC2C(=O)N2CCOCC2)OC1(C)C |
| InChI | InChI=1S/C30H40BN5O6/c1-28(2)29(3,4)42-31(41-28)24(12-8-11-21-9-6-5-7-10-21)34-27(39)30(35-25(37)23-20-32-13-14-33-23)19-22(30)26(38)36-15-17-40-18-16-36/h5-7,9-10,13-14,20,22,24H,8,11-12,15-19H2,1-4H3,(H,34,39)(H,35,37)/t22?,24-,30?/m0/s1 |
| InChIKey | LRNOPKZGYOIOKV-FHGPBERCSA-N |
| XLogP | 1.96 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|