C12H14Cl2O3S2 — CID 57200637
2-(ethyldisulfanyl)ethyl 2-(2,4-dichlorophenoxy)acetate (PubChem CID 57200637) has the molecular formula C12H14Cl2O3S2 and a molecular weight of 341.28 g/mol. Its IUPAC name is 2-(ethyldisulfanyl)ethyl 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | 2-(ethyldisulfanyl)ethyl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 57200637 |
| Molecular Formula | C12H14Cl2O3S2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2-(ethyldisulfanyl)ethyl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CCSSCCOC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O3S2/c1-2-18-19-6-5-16-12(15)8-17-11-4-3-9(13)7-10(11)14/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | XGGDXAAJRDNFSL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|