C12H12Cl2N2O3 — CID 110191882
2-[cyano(methyl)amino]ethyl 2-(2,4-dichlorophenoxy)acetate (PubChem CID 110191882) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.14 g/mol. Its IUPAC name is 2-[cyano(methyl)amino]ethyl 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | 2-[cyano(methyl)amino]ethyl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 110191882 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-[cyano(methyl)amino]ethyl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CN(C#N)CCOC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-16(8-15)4-5-18-12(17)7-19-11-3-2-9(13)6-10(11)14/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | OHAWACLQUAUTKJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|