C19H27BO4 — CID 162414035
[(E)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl] propanoate (PubChem CID 162414035) has the molecular formula C19H27BO4 and a molecular weight of 330.23 g/mol. Its IUPAC name is [(E)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl] propanoate.
| Compound Name | [(E)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl] propanoate |
|---|---|
| PubChem CID | 162414035 |
| Molecular Formula | C19H27BO4 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | [(E)-2-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl] propanoate |
| SMILES | CCC(=O)O/C=C(/c1ccccc1)C(C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H27BO4/c1-7-17(21)22-13-16(15-11-9-8-10-12-15)14(2)20-23-18(3,4)19(5,6)24-20/h8-14H,7H2,1-6H3/b16-13+ |
| InChIKey | SPEQIZHPJKRPTF-DTQAZKPQSA-N |
| XLogP | 4.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|