C19H31BN2O5 — CID 168920056
N-[(1R,2R,3R)-2-amino-3-methoxy-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide (PubChem CID 168920056) has the molecular formula C19H31BN2O5 and a molecular weight of 378.28 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-amino-3-methoxy-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide.
| Compound Name | N-[(1R,2R,3R)-2-amino-3-methoxy-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 168920056 |
| Molecular Formula | C19H31BN2O5 |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-[(1R,2R,3R)-2-amino-3-methoxy-3-phenoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]propanamide |
| SMILES | CCC(=O)N[C@H](B1OC(C)(C)C(C)(C)O1)[C@@H](N)[C@H](OC)Oc1ccccc1 |
| InChI | InChI=1S/C19H31BN2O5/c1-7-14(23)22-16(20-26-18(2,3)19(4,5)27-20)15(21)17(24-6)25-13-11-9-8-10-12-13/h8-12,15-17H,7,21H2,1-6H3,(H,22,23)/t15-,16+,17-/m1/s1 |
| InChIKey | APDNNYJGHKLCAV-IXDOHACOSA-N |
| XLogP | 1.89 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|