C23H22N2O4 — CID 23913160
N-[4-[(2,2-diphenoxyacetyl)amino]phenyl]propanamide (PubChem CID 23913160) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[4-[(2,2-diphenoxyacetyl)amino]phenyl]propanamide.
| Compound Name | N-[4-[(2,2-diphenoxyacetyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 23913160 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[4-[(2,2-diphenoxyacetyl)amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)C(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-2-21(26)24-17-13-15-18(16-14-17)25-22(27)23(28-19-9-5-3-6-10-19)29-20-11-7-4-8-12-20/h3-16,23H,2H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | XQKCRNLTSBCGKV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|