C19H29NO2S — CID 56978441
2-(5-decyl-2H-1,3-thiazol-3-yl)-1-(furan-2-yl)ethanone (PubChem CID 56978441) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is 2-(5-decyl-2H-1,3-thiazol-3-yl)-1-(furan-2-yl)ethanone.
| Compound Name | 2-(5-decyl-2H-1,3-thiazol-3-yl)-1-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 56978441 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-(5-decyl-2H-1,3-thiazol-3-yl)-1-(furan-2-yl)ethanone |
| SMILES | CCCCCCCCCCC1=CN(CC(=O)c2ccco2)CS1 |
| InChI | InChI=1S/C19H29NO2S/c1-2-3-4-5-6-7-8-9-11-17-14-20(16-23-17)15-18(21)19-12-10-13-22-19/h10,12-14H,2-9,11,15-16H2,1H3 |
| InChIKey | XEZVIAHKOGTKQJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|