C15H19F3N2O3 — CID 40502190
furan-2-yl-[(5S)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (PubChem CID 40502190) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is furan-2-yl-[(5S)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone.
| Compound Name | furan-2-yl-[(5S)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 40502190 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | furan-2-yl-[(5S)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
| SMILES | CCCCCCC1=NN(C(=O)c2ccco2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-2-3-4-5-7-11-10-14(22,15(16,17)18)20(19-11)13(21)12-8-6-9-23-12/h6,8-9,22H,2-5,7,10H2,1H3/t14-/m0/s1 |
| InChIKey | VAEVQOSYRNUDPI-AWEZNQCLSA-N |
| XLogP | 3.70 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|