C15H17F3N2O3 — CID 39388505
[(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-hydroxyphenyl)methanone (PubChem CID 39388505) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is [(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-hydroxyphenyl)methanone.
| Compound Name | [(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 39388505 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(3-hydroxyphenyl)methanone |
| SMILES | CCCCC1=NN(C(=O)c2cccc(O)c2)[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H17F3N2O3/c1-2-3-6-11-9-14(23,15(16,17)18)20(19-11)13(22)10-5-4-7-12(21)8-10/h4-5,7-8,21,23H,2-3,6,9H2,1H3/t14-/m1/s1 |
| InChIKey | HYAOUEBBSPSSAQ-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |