C18H23F3N2O2 — CID 7279684
[(5R)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methylphenyl)methanone (PubChem CID 7279684) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is [(5R)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [(5R)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 7279684 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [(5R)-3-hexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-methylphenyl)methanone |
| SMILES | CCCCCCC1=NN(C(=O)c2ccc(C)cc2)[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-3-4-5-6-7-15-12-17(25,18(19,20)21)23(22-15)16(24)14-10-8-13(2)9-11-14/h8-11,25H,3-7,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | ZFIDZLZFXVQDLI-QGZVFWFLSA-N |
| XLogP | 4.42 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|