C14H14F4N2O2 — CID 39347108
(4-fluorophenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (PubChem CID 39347108) has the molecular formula C14H14F4N2O2 and a molecular weight of 318.27 g/mol. Its IUPAC name is (4-fluorophenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 39347108 |
| Molecular Formula | C14H14F4N2O2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (4-fluorophenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
| SMILES | CCCC1=NN(C(=O)c2ccc(F)cc2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H14F4N2O2/c1-2-3-11-8-13(22,14(16,17)18)20(19-11)12(21)9-4-6-10(15)7-5-9/h4-7,22H,2-3,8H2,1H3/t13-/m0/s1 |
| InChIKey | QQQLEDYMFYXCHR-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |