C14H15F3N2O3 — CID 713974
(3-hydroxyphenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (PubChem CID 713974) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is (3-hydroxyphenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone.
| Compound Name | (3-hydroxyphenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 713974 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3-hydroxyphenyl)-[(5S)-5-hydroxy-3-propyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
| SMILES | CCCC1=NN(C(=O)c2cccc(O)c2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H15F3N2O3/c1-2-4-10-8-13(22,14(15,16)17)19(18-10)12(21)9-5-3-6-11(20)7-9/h3,5-7,20,22H,2,4,8H2,1H3/t13-/m0/s1 |
| InChIKey | QQUZGIUSOJXYRJ-ZDUSSCGKSA-N |
| XLogP | 2.65 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |