C16H18ClF3N2O2 — CID 7182302
(2-chlorophenyl)-[(5S)-5-hydroxy-3-pentyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (PubChem CID 7182302) has the molecular formula C16H18ClF3N2O2 and a molecular weight of 362.78 g/mol. Its IUPAC name is (2-chlorophenyl)-[(5S)-5-hydroxy-3-pentyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(5S)-5-hydroxy-3-pentyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 7182302 |
| Molecular Formula | C16H18ClF3N2O2 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (2-chlorophenyl)-[(5S)-5-hydroxy-3-pentyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
| SMILES | CCCCCC1=NN(C(=O)c2ccccc2Cl)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H18ClF3N2O2/c1-2-3-4-7-11-10-15(24,16(18,19)20)22(21-11)14(23)12-8-5-6-9-13(12)17/h5-6,8-9,24H,2-4,7,10H2,1H3/t15-/m0/s1 |
| InChIKey | KJIBYRJWNMVMMJ-HNNXBMFYSA-N |
| XLogP | 4.37 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|