C16H19F3N2O3 — CID 7122778
[(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(2-methoxyphenyl)methanone (PubChem CID 7122778) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is [(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 7122778 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [(5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(2-methoxyphenyl)methanone |
| SMILES | CCCCC1=NN(C(=O)c2ccccc2OC)[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H19F3N2O3/c1-3-4-7-11-10-15(23,16(17,18)19)21(20-11)14(22)12-8-5-6-9-13(12)24-2/h5-6,8-9,23H,3-4,7,10H2,1-2H3/t15-/m1/s1 |
| InChIKey | SQAUBGCOYNSMEP-OAHLLOKOSA-N |
| XLogP | 3.34 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |