C15H22N2O3S — CID 175397948
4-ethenylbenzenesulfonic acid;1-methyl-3-propyl-2H-imidazole (PubChem CID 175397948) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-ethenylbenzenesulfonic acid;1-methyl-3-propyl-2H-imidazole.
| Compound Name | 4-ethenylbenzenesulfonic acid;1-methyl-3-propyl-2H-imidazole |
|---|---|
| PubChem CID | 175397948 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-ethenylbenzenesulfonic acid;1-methyl-3-propyl-2H-imidazole |
| SMILES | C=Cc1ccc(S(=O)(=O)O)cc1.CCCN1C=CN(C)C1 |
| InChI | InChI=1S/C8H8O3S.C7H14N2/c1-2-7-3-5-8(6-4-7)12(9,10)11;1-3-4-9-6-5-8(2)7-9/h2-6H,1H2,(H,9,10,11);5-6H,3-4,7H2,1-2H3 |
| InChIKey | LQSXPDNGZVWXPY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|