C7H12F3N3O3S — CID 174802569
3-imidazol-1-ylpropan-1-amine;trifluoromethanesulfonic acid (PubChem CID 174802569) has the molecular formula C7H12F3N3O3S and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-imidazol-1-ylpropan-1-amine;trifluoromethanesulfonic acid.
| Compound Name | 3-imidazol-1-ylpropan-1-amine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174802569 |
| Molecular Formula | C7H12F3N3O3S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-imidazol-1-ylpropan-1-amine;trifluoromethanesulfonic acid |
| SMILES | NCCCn1ccnc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H11N3.CHF3O3S/c7-2-1-4-9-5-3-8-6-9;2-1(3,4)8(5,6)7/h3,5-6H,1-2,4,7H2;(H,5,6,7) |
| InChIKey | QJLCKNKAXXEQOW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|