C11H19N7O2S — CID 106076996
5-methyl-3-(methylaminomethyl)-N-[3-(triazol-1-yl)propyl]-1H-pyrazole-4-sulfonamide (PubChem CID 106076996) has the molecular formula C11H19N7O2S and a molecular weight of 313.39 g/mol. Its IUPAC name is 5-methyl-3-(methylaminomethyl)-N-[3-(triazol-1-yl)propyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-3-(methylaminomethyl)-N-[3-(triazol-1-yl)propyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106076996 |
| Molecular Formula | C11H19N7O2S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-methyl-3-(methylaminomethyl)-N-[3-(triazol-1-yl)propyl]-1H-pyrazole-4-sulfonamide |
| SMILES | CNCc1n[nH]c(C)c1S(=O)(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C11H19N7O2S/c1-9-11(10(8-12-2)16-15-9)21(19,20)14-4-3-6-18-7-5-13-17-18/h5,7,12,14H,3-4,6,8H2,1-2H3,(H,15,16) |
| InChIKey | LQWRHKUTFYDVGQ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|