C12H29N3O2S2 — CID 106080844
2-methyl-1-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]-2-methylsulfanylpropane (PubChem CID 106080844) has the molecular formula C12H29N3O2S2 and a molecular weight of 311.52 g/mol. Its IUPAC name is 2-methyl-1-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]-2-methylsulfanylpropane.
| Compound Name | 2-methyl-1-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]-2-methylsulfanylpropane |
|---|---|
| PubChem CID | 106080844 |
| Molecular Formula | C12H29N3O2S2 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-methyl-1-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]-2-methylsulfanylpropane |
| SMILES | CSC(C)(C)CNS(=O)(=O)N(C)CCCNC(C)C |
| InChI | InChI=1S/C12H29N3O2S2/c1-11(2)13-8-7-9-15(5)19(16,17)14-10-12(3,4)18-6/h11,13-14H,7-10H2,1-6H3 |
| InChIKey | KMQFOQCUHBUPSI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|