C12H29N3O2S — CID 114138802
2-methyl-2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]butane (PubChem CID 114138802) has the molecular formula C12H29N3O2S and a molecular weight of 279.45 g/mol. Its IUPAC name is 2-methyl-2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]butane.
| Compound Name | 2-methyl-2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]butane |
|---|---|
| PubChem CID | 114138802 |
| Molecular Formula | C12H29N3O2S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-methyl-2-[[methyl-[3-(propan-2-ylamino)propyl]sulfamoyl]amino]butane |
| SMILES | CCC(C)(C)NS(=O)(=O)N(C)CCCNC(C)C |
| InChI | InChI=1S/C12H29N3O2S/c1-7-12(4,5)14-18(16,17)15(6)10-8-9-13-11(2)3/h11,13-14H,7-10H2,1-6H3 |
| InChIKey | SJXKYMFWMPMRNJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|