C10H24N2O3S — CID 107203013
1-[tert-butylsulfamoyl(methyl)amino]-5-hydroxypentane (PubChem CID 107203013) has the molecular formula C10H24N2O3S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[tert-butylsulfamoyl(methyl)amino]-5-hydroxypentane.
| Compound Name | 1-[tert-butylsulfamoyl(methyl)amino]-5-hydroxypentane |
|---|---|
| PubChem CID | 107203013 |
| Molecular Formula | C10H24N2O3S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-[tert-butylsulfamoyl(methyl)amino]-5-hydroxypentane |
| SMILES | CN(CCCCCO)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H24N2O3S/c1-10(2,3)11-16(14,15)12(4)8-6-5-7-9-13/h11,13H,5-9H2,1-4H3 |
| InChIKey | FLANKCKZVONTJZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|