C12H24N2O3S — CID 102971594
N-[2-(3-methoxy-4-methylpiperidin-1-yl)sulfonylethyl]cyclopropanamine (PubChem CID 102971594) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is N-[2-(3-methoxy-4-methylpiperidin-1-yl)sulfonylethyl]cyclopropanamine.
| Compound Name | N-[2-(3-methoxy-4-methylpiperidin-1-yl)sulfonylethyl]cyclopropanamine |
|---|---|
| PubChem CID | 102971594 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[2-(3-methoxy-4-methylpiperidin-1-yl)sulfonylethyl]cyclopropanamine |
| SMILES | COC1CN(S(=O)(=O)CCNC2CC2)CCC1C |
| InChI | InChI=1S/C12H24N2O3S/c1-10-5-7-14(9-12(10)17-2)18(15,16)8-6-13-11-3-4-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | HVFODSKOQKEVOI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |