C9H21N3O3S — CID 62688438
N-(2-aminoethyl)-N,2,6-trimethylmorpholine-4-sulfonamide (PubChem CID 62688438) has the molecular formula C9H21N3O3S and a molecular weight of 251.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-N,2,6-trimethylmorpholine-4-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N,2,6-trimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 62688438 |
| Molecular Formula | C9H21N3O3S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-(2-aminoethyl)-N,2,6-trimethylmorpholine-4-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)N(C)CCN)CC(C)O1 |
| InChI | InChI=1S/C9H21N3O3S/c1-8-6-12(7-9(2)15-8)16(13,14)11(3)5-4-10/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | ABJAAQQUQAFHFO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |