C15H24N2O4S — CID 51330696
N,2,6-trimethyl-N-(2-phenoxyethyl)morpholine-4-sulfonamide (PubChem CID 51330696) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N,2,6-trimethyl-N-(2-phenoxyethyl)morpholine-4-sulfonamide.
| Compound Name | N,2,6-trimethyl-N-(2-phenoxyethyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 51330696 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N,2,6-trimethyl-N-(2-phenoxyethyl)morpholine-4-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)N(C)CCOc2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C15H24N2O4S/c1-13-11-17(12-14(2)21-13)22(18,19)16(3)9-10-20-15-7-5-4-6-8-15/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | UXFUCEJDGHQLQC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |