C7H16ClN3O4S2 — CID 61248403
4-(3-chloropropylsulfonyl)piperazine-1-sulfonamide (PubChem CID 61248403) has the molecular formula C7H16ClN3O4S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-(3-chloropropylsulfonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(3-chloropropylsulfonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61248403 |
| Molecular Formula | C7H16ClN3O4S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 4-(3-chloropropylsulfonyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(S(=O)(=O)CCCCl)CC1 |
| InChI | InChI=1S/C7H16ClN3O4S2/c8-2-1-7-16(12,13)10-3-5-11(6-4-10)17(9,14)15/h1-7H2,(H2,9,14,15) |
| InChIKey | OQVFKPVKJSTKMP-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|