C7H17N3O6S3 — CID 63242667
4-(2-methylsulfonylethylsulfonyl)piperazine-1-sulfonamide (PubChem CID 63242667) has the molecular formula C7H17N3O6S3 and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-(2-methylsulfonylethylsulfonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(2-methylsulfonylethylsulfonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 63242667 |
| Molecular Formula | C7H17N3O6S3 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 4-(2-methylsulfonylethylsulfonyl)piperazine-1-sulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C7H17N3O6S3/c1-17(11,12)6-7-18(13,14)9-2-4-10(5-3-9)19(8,15)16/h2-7H2,1H3,(H2,8,15,16) |
| InChIKey | KLCHAFKJBOWGTG-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |