C13H27N3O2S — CID 114537834
1,2,6-trimethyl-4-(piperidin-2-ylmethylsulfonyl)piperazine (PubChem CID 114537834) has the molecular formula C13H27N3O2S and a molecular weight of 289.44 g/mol. Its IUPAC name is 1,2,6-trimethyl-4-(piperidin-2-ylmethylsulfonyl)piperazine.
| Compound Name | 1,2,6-trimethyl-4-(piperidin-2-ylmethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 114537834 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1,2,6-trimethyl-4-(piperidin-2-ylmethylsulfonyl)piperazine |
| SMILES | CC1CN(S(=O)(=O)CC2CCCCN2)CC(C)N1C |
| InChI | InChI=1S/C13H27N3O2S/c1-11-8-16(9-12(2)15(11)3)19(17,18)10-13-6-4-5-7-14-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | NIEBUSOOJJQODT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |