C10H19N3O3S — CID 54973565
4-(piperidin-2-ylmethylsulfonyl)piperazin-2-one (PubChem CID 54973565) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-(piperidin-2-ylmethylsulfonyl)piperazin-2-one.
| Compound Name | 4-(piperidin-2-ylmethylsulfonyl)piperazin-2-one |
|---|---|
| PubChem CID | 54973565 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-(piperidin-2-ylmethylsulfonyl)piperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)CC2CCCCN2)CCN1 |
| InChI | InChI=1S/C10H19N3O3S/c14-10-7-13(6-5-12-10)17(15,16)8-9-3-1-2-4-11-9/h9,11H,1-8H2,(H,12,14) |
| InChIKey | UDWWPNPDNFHJQR-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |