C9H17N3O3S — CID 134120945
4-methyl-1-piperidin-1-ylsulfonylpyrazolidin-3-one (PubChem CID 134120945) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-methyl-1-piperidin-1-ylsulfonylpyrazolidin-3-one.
| Compound Name | 4-methyl-1-piperidin-1-ylsulfonylpyrazolidin-3-one |
|---|---|
| PubChem CID | 134120945 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-methyl-1-piperidin-1-ylsulfonylpyrazolidin-3-one |
| SMILES | CC1CN(S(=O)(=O)N2CCCCC2)NC1=O |
| InChI | InChI=1S/C9H17N3O3S/c1-8-7-12(10-9(8)13)16(14,15)11-5-3-2-4-6-11/h8H,2-7H2,1H3,(H,10,13) |
| InChIKey | LZJLSJIWMVKNEL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |