C12H18Cl2N2O2S2 — CID 120583982
2-(5-chlorothiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120583982) has the molecular formula C12H18Cl2N2O2S2 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-(5-chlorothiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120583982 |
| Molecular Formula | C12H18Cl2N2O2S2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | Cl.NC1CCCC2CN(S(=O)(=O)c3ccc(Cl)s3)CC12 |
| InChI | InChI=1S/C12H17ClN2O2S2.ClH/c13-11-4-5-12(18-11)19(16,17)15-6-8-2-1-3-10(14)9(8)7-15;/h4-5,8-10H,1-3,6-7,14H2;1H |
| InChIKey | DAFZLBIOWBPJST-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |