C18H22N2O3S2 — CID 95088355
(3R)-N-benzyl-3-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 95088355) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (3R)-N-benzyl-3-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-benzyl-3-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95088355 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (3R)-N-benzyl-3-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | C[C@@]1(C(=O)NCc2ccccc2)CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-18(17(21)19-13-15-7-3-2-4-8-15)10-6-11-20(14-18)25(22,23)16-9-5-12-24-16/h2-5,7-9,12H,6,10-11,13-14H2,1H3,(H,19,21)/t18-/m1/s1 |
| InChIKey | SLYQFEVGCAHWGW-GOSISDBHSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |