C18H21FN2O3S2 — CID 53070906
N-[(4-fluorophenyl)methyl]-4-methyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 53070906) has the molecular formula C18H21FN2O3S2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-methyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-methyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 53070906 |
| Molecular Formula | C18H21FN2O3S2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-methyl-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CC1(C(=O)NCc2ccc(F)cc2)CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H21FN2O3S2/c1-18(17(22)20-13-14-4-6-15(19)7-5-14)8-10-21(11-9-18)26(23,24)16-3-2-12-25-16/h2-7,12H,8-11,13H2,1H3,(H,20,22) |
| InChIKey | ZKLINZMXJXBKAD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |