C16H23N3O — CID 97481759
[(5R)-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 97481759) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is [(5R)-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(5R)-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 97481759 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | [(5R)-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-9-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | C=CCN1CCC[C@]12CCCN(C(=O)c1ccc[nH]1)C2 |
| InChI | InChI=1S/C16H23N3O/c1-2-10-19-12-5-8-16(19)7-4-11-18(13-16)15(20)14-6-3-9-17-14/h2-3,6,9,17H,1,4-5,7-8,10-13H2/t16-/m0/s1 |
| InChIKey | YCSRFCGZTQPQNO-INIZCTEOSA-N |
| XLogP | 2.27 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|