C17H25N3O — CID 97385696
(1-methylpyrrol-2-yl)-(1-prop-2-enyl-1,8-diazaspiro[4.5]decan-8-yl)methanone (PubChem CID 97385696) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (1-methylpyrrol-2-yl)-(1-prop-2-enyl-1,8-diazaspiro[4.5]decan-8-yl)methanone.
| Compound Name | (1-methylpyrrol-2-yl)-(1-prop-2-enyl-1,8-diazaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 97385696 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (1-methylpyrrol-2-yl)-(1-prop-2-enyl-1,8-diazaspiro[4.5]decan-8-yl)methanone |
| SMILES | C=CCN1CCCC12CCN(C(=O)c1cccn1C)CC2 |
| InChI | InChI=1S/C17H25N3O/c1-3-10-20-12-5-7-17(20)8-13-19(14-9-17)16(21)15-6-4-11-18(15)2/h3-4,6,11H,1,5,7-10,12-14H2,2H3 |
| InChIKey | BRAOQRPIPMKIFC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|