C19H28N4O2 — CID 97495285
(5S)-2-(1-methylpyrrole-2-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one (PubChem CID 97495285) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (5S)-2-(1-methylpyrrole-2-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one.
| Compound Name | (5S)-2-(1-methylpyrrole-2-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 97495285 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (5S)-2-(1-methylpyrrole-2-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one |
| SMILES | C=CCN1CCN(C(C)C)C(=O)[C@@]12CCN(C(=O)c1cccn1C)C2 |
| InChI | InChI=1S/C19H28N4O2/c1-5-9-22-12-13-23(15(2)3)18(25)19(22)8-11-21(14-19)17(24)16-7-6-10-20(16)4/h5-7,10,15H,1,8-9,11-14H2,2-4H3/t19-/m0/s1 |
| InChIKey | DCQMHDTUZAVJAC-IBGZPJMESA-N |
| XLogP | 1.35 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|