C18H27N5O2 — CID 97495284
(5S)-2-(5-methyl-1H-pyrazole-3-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one (PubChem CID 97495284) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (5S)-2-(5-methyl-1H-pyrazole-3-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one.
| Compound Name | (5S)-2-(5-methyl-1H-pyrazole-3-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 97495284 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (5S)-2-(5-methyl-1H-pyrazole-3-carbonyl)-9-propan-2-yl-6-prop-2-enyl-2,6,9-triazaspiro[4.5]decan-10-one |
| SMILES | C=CCN1CCN(C(C)C)C(=O)[C@@]12CCN(C(=O)c1cc(C)[nH]n1)C2 |
| InChI | InChI=1S/C18H27N5O2/c1-5-7-22-9-10-23(13(2)3)17(25)18(22)6-8-21(12-18)16(24)15-11-14(4)19-20-15/h5,11,13H,1,6-10,12H2,2-4H3,(H,19,20)/t18-/m0/s1 |
| InChIKey | UHVIYTHGEMKXGQ-SFHVURJKSA-N |
| XLogP | 1.04 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|