C17H22N4O2 — CID 97495229
(5S)-9-methyl-6-prop-2-enyl-2-(pyridine-4-carbonyl)-2,6,9-triazaspiro[4.5]decan-10-one (PubChem CID 97495229) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (5S)-9-methyl-6-prop-2-enyl-2-(pyridine-4-carbonyl)-2,6,9-triazaspiro[4.5]decan-10-one.
| Compound Name | (5S)-9-methyl-6-prop-2-enyl-2-(pyridine-4-carbonyl)-2,6,9-triazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 97495229 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (5S)-9-methyl-6-prop-2-enyl-2-(pyridine-4-carbonyl)-2,6,9-triazaspiro[4.5]decan-10-one |
| SMILES | C=CCN1CCN(C)C(=O)[C@@]12CCN(C(=O)c1ccncc1)C2 |
| InChI | InChI=1S/C17H22N4O2/c1-3-9-21-12-11-19(2)16(23)17(21)6-10-20(13-17)15(22)14-4-7-18-8-5-14/h3-5,7-8H,1,6,9-13H2,2H3/t17-/m0/s1 |
| InChIKey | HUNLEAUCWYHLID-KRWDZBQOSA-N |
| XLogP | 0.63 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|